C25H27Cl2N5O2S — CID 135662901
2-butylsulfanyl-7-(2,4-dichlorophenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662901) has the molecular formula C25H27Cl2N5O2S and a molecular weight of 532.50 g/mol. Its IUPAC name is 2-butylsulfanyl-7-(2,4-dichlorophenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-butylsulfanyl-7-(2,4-dichlorophenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662901 |
| Molecular Formula | C25H27Cl2N5O2S |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 2-butylsulfanyl-7-(2,4-dichlorophenyl)-N-(2-ethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(Cl)cc1Cl)C(C(=O)Nc1ccccc1OCC)=C(C)N2 |
| InChI | InChI=1S/C25H27Cl2N5O2S/c1-4-6-13-35-25-30-24-28-15(3)21(23(33)29-19-9-7-8-10-20(19)34-5-2)22(32(24)31-25)17-12-11-16(26)14-18(17)27/h7-12,14,22H,4-6,13H2,1-3H3,(H,29,33)(H,28,30,31) |
| InChIKey | GIXFGJMJRNDFFO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|