C23H22ClN5O6 — CID 135666274
ethyl 2-(4-chlorophenyl)-7-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135666274) has the molecular formula C23H22ClN5O6 and a molecular weight of 499.91 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-7-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-(4-chlorophenyl)-7-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135666274 |
| Molecular Formula | C23H22ClN5O6 |
| Molecular Weight | 499.91 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-7-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(-c3ccc(Cl)cc3)nn2C1c1cc(OCC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22ClN5O6/c1-4-34-17-11-14(10-16(20(17)30)29(32)33)19-18(22(31)35-5-2)12(3)25-23-26-21(27-28(19)23)13-6-8-15(24)9-7-13/h6-11,19,30H,4-5H2,1-3H3,(H,25,26,27) |
| InChIKey | VIWHAFWERAFEKX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|