C11H13N3O3 — CID 135666294
(2E,3E)-2,3-bis(hydroxyimino)-N-methyl-N-phenylbutanamide (PubChem CID 135666294) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is (2E,3E)-2,3-bis(hydroxyimino)-N-methyl-N-phenylbutanamide.
| Compound Name | (2E,3E)-2,3-bis(hydroxyimino)-N-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 135666294 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (2E,3E)-2,3-bis(hydroxyimino)-N-methyl-N-phenylbutanamide |
| SMILES | CC(=N\O)/C(=N\O)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C11H13N3O3/c1-8(12-16)10(13-17)11(15)14(2)9-6-4-3-5-7-9/h3-7,16-17H,1-2H3/b12-8+,13-10+ |
| InChIKey | CWBJGAHMHDUAJY-SDCOAONHSA-N |
| XLogP | 1.33 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|