About N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide
N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide (PubChem CID 47333935) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide |
| PubChem CID | 47333935 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O3/c1-10(17)14-8-9-15-12(18)13(19)16(2)11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | RDMAREBKKYJHSB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide?
The IUPAC name of N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide (CID 47333935) is N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide.
What is the SMILES notation for N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide?
The canonical SMILES for N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide is CC(=O)NCCNC(=O)C(=O)N(C)c1ccccc1.
What is the InChIKey of N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide?
The InChIKey is RDMAREBKKYJHSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-10(17)14-8-9-15-12(18)13(19)16(2)11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3,(H,14,17)(H,15,18).
What are the key properties of N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide?
N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide has a molecular weight of 263.30 g/mol, XLogP of -0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetamidoethyl)-N'-methyl-N'-phenyloxamide is sourced from PubChem (CID 47333935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).