C12H17N3O2 — CID 62003887
N-(2-aminoethyl)-N'-methyl-N'-(3-methylphenyl)oxamide (PubChem CID 62003887) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-methyl-N'-(3-methylphenyl)oxamide.
| Compound Name | N-(2-aminoethyl)-N'-methyl-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 62003887 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-(2-aminoethyl)-N'-methyl-N'-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(N(C)C(=O)C(=O)NCCN)c1 |
| InChI | InChI=1S/C12H17N3O2/c1-9-4-3-5-10(8-9)15(2)12(17)11(16)14-7-6-13/h3-5,8H,6-7,13H2,1-2H3,(H,14,16) |
| InChIKey | QFPATTUANOEOHJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|