C14H20N2O3 — CID 108520926
N-(5-hydroxypentyl)-N'-methyl-N'-phenyloxamide (PubChem CID 108520926) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N'-methyl-N'-phenyloxamide.
| Compound Name | N-(5-hydroxypentyl)-N'-methyl-N'-phenyloxamide |
|---|---|
| PubChem CID | 108520926 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(5-hydroxypentyl)-N'-methyl-N'-phenyloxamide |
| SMILES | CN(C(=O)C(=O)NCCCCCO)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O3/c1-16(12-8-4-2-5-9-12)14(19)13(18)15-10-6-3-7-11-17/h2,4-5,8-9,17H,3,6-7,10-11H2,1H3,(H,15,18) |
| InChIKey | NXSVDSIPPLKWFF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|