C17H14N4O2S — CID 135674296
4-[3-(thiophen-2-ylmethylamino)imidazo[1,2-a]pyrazin-2-yl]benzene-1,2-diol (PubChem CID 135674296) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 4-[3-(thiophen-2-ylmethylamino)imidazo[1,2-a]pyrazin-2-yl]benzene-1,2-diol.
| Compound Name | 4-[3-(thiophen-2-ylmethylamino)imidazo[1,2-a]pyrazin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135674296 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-[3-(thiophen-2-ylmethylamino)imidazo[1,2-a]pyrazin-2-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2nc3cnccn3c2NCc2cccs2)cc1O |
| InChI | InChI=1S/C17H14N4O2S/c22-13-4-3-11(8-14(13)23)16-17(19-9-12-2-1-7-24-12)21-6-5-18-10-15(21)20-16/h1-8,10,19,22-23H,9H2 |
| InChIKey | AGHXGXWEGCHIFF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|