C17H16BrClN4O5S — CID 135675564
(Z)-2-[[5-[(3-bromo-4-methoxyphenyl)sulfamoyl]-2-chlorophenyl]diazenyl]-3-hydroxybut-2-enamide (PubChem CID 135675564) has the molecular formula C17H16BrClN4O5S and a molecular weight of 503.76 g/mol. Its IUPAC name is (Z)-2-[[5-[(3-bromo-4-methoxyphenyl)sulfamoyl]-2-chlorophenyl]diazenyl]-3-hydroxybut-2-enamide.
| Compound Name | (Z)-2-[[5-[(3-bromo-4-methoxyphenyl)sulfamoyl]-2-chlorophenyl]diazenyl]-3-hydroxybut-2-enamide |
|---|---|
| PubChem CID | 135675564 |
| Molecular Formula | C17H16BrClN4O5S |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 501.97 |
| IUPAC Name | (Z)-2-[[5-[(3-bromo-4-methoxyphenyl)sulfamoyl]-2-chlorophenyl]diazenyl]-3-hydroxybut-2-enamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(Cl)c(/N=N/C(C(N)=O)=C(/C)O)c2)cc1Br |
| InChI | InChI=1S/C17H16BrClN4O5S/c1-9(24)16(17(20)25)22-21-14-8-11(4-5-13(14)19)29(26,27)23-10-3-6-15(28-2)12(18)7-10/h3-8,23-24H,1-2H3,(H2,20,25)/b16-9-,22-21+ |
| InChIKey | CTZRFUFHFLBQGJ-CWRHKCGHSA-N |
| XLogP | 4.27 |
| TPSA | 143.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|