C26H33N5O3 — CID 135676213
1-(4,6-dimethylpyrimidin-2-yl)-3,7,7-trimethyl-4-(5-methylfuran-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one;ethanol (PubChem CID 135676213) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3,7,7-trimethyl-4-(5-methylfuran-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one;ethanol.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3,7,7-trimethyl-4-(5-methylfuran-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one;ethanol |
|---|---|
| PubChem CID | 135676213 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3,7,7-trimethyl-4-(5-methylfuran-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one;ethanol |
| SMILES | CCO.Cc1cc(C)nc(-n2nc(C)c3c2NC2=C(C(=O)CC(C)(C)C2)C3c2ccc(C)o2)n1 |
| InChI | InChI=1S/C24H27N5O2.C2H6O/c1-12-9-13(2)26-23(25-12)29-22-19(15(4)28-29)21(18-8-7-14(3)31-18)20-16(27-22)10-24(5,6)11-17(20)30;1-2-3/h7-9,21,27H,10-11H2,1-6H3;3H,2H2,1H3 |
| InChIKey | IUIIHOPKSOUATO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |