C19H12N6O4S — CID 135677372
(3Z)-3-[[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]imino]-5-nitro-1H-indol-2-one (PubChem CID 135677372) has the molecular formula C19H12N6O4S and a molecular weight of 420.41 g/mol. Its IUPAC name is (3Z)-3-[[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]imino]-5-nitro-1H-indol-2-one.
| Compound Name | (3Z)-3-[[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]imino]-5-nitro-1H-indol-2-one |
|---|---|
| PubChem CID | 135677372 |
| Molecular Formula | C19H12N6O4S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (3Z)-3-[[4-(1,3-benzothiazol-2-yl)-3-hydroxy-5-imino-2H-pyrrol-1-yl]imino]-5-nitro-1H-indol-2-one |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1/N=C1\C(=O)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H12N6O4S/c20-17-15(19-22-12-3-1-2-4-14(12)30-19)13(26)8-24(17)23-16-10-7-9(25(28)29)5-6-11(10)21-18(16)27/h1-7,20,26H,8H2,(H,21,23,27)/b20-17- |
| InChIKey | LJPUOIGZGOJXNN-JZJYNLBNSA-N |
| XLogP | 3.12 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|