C25H48N4O7S — CID 135681485
(3R)-3-[[(2R)-3-methyl-1-[3-(morpholin-4-ylsulfonylamino)propylamino]-1-oxobutan-2-yl]carbamoyl]dodecanoic acid (PubChem CID 135681485) has the molecular formula C25H48N4O7S and a molecular weight of 548.75 g/mol. Its IUPAC name is (3R)-3-[[(2R)-3-methyl-1-[3-(morpholin-4-ylsulfonylamino)propylamino]-1-oxobutan-2-yl]carbamoyl]dodecanoic acid.
| Compound Name | (3R)-3-[[(2R)-3-methyl-1-[3-(morpholin-4-ylsulfonylamino)propylamino]-1-oxobutan-2-yl]carbamoyl]dodecanoic acid |
|---|---|
| PubChem CID | 135681485 |
| Molecular Formula | C25H48N4O7S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | (3R)-3-[[(2R)-3-methyl-1-[3-(morpholin-4-ylsulfonylamino)propylamino]-1-oxobutan-2-yl]carbamoyl]dodecanoic acid |
| SMILES | CCCCCCCCC[C@H](CC(=O)O)C(=O)N[C@@H](C(=O)NCCCNS(=O)(=O)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C25H48N4O7S/c1-4-5-6-7-8-9-10-12-21(19-22(30)31)24(32)28-23(20(2)3)25(33)26-13-11-14-27-37(34,35)29-15-17-36-18-16-29/h20-21,23,27H,4-19H2,1-3H3,(H,26,33)(H,28,32)(H,30,31)/t21-,23-/m1/s1 |
| InChIKey | GPWOYTLYNGSJAV-FYYLOGMGSA-N |
| XLogP | 2.03 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|