C24H45N3O5 — CID 135581536
(3R)-3-[[(2R)-3-methyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]carbamoyl]dodecanoic acid (PubChem CID 135581536) has the molecular formula C24H45N3O5 and a molecular weight of 455.64 g/mol. Its IUPAC name is (3R)-3-[[(2R)-3-methyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]carbamoyl]dodecanoic acid.
| Compound Name | (3R)-3-[[(2R)-3-methyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]carbamoyl]dodecanoic acid |
|---|---|
| PubChem CID | 135581536 |
| Molecular Formula | C24H45N3O5 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.34 |
| IUPAC Name | (3R)-3-[[(2R)-3-methyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]carbamoyl]dodecanoic acid |
| SMILES | CCCCCCCCC[C@H](CC(=O)O)C(=O)N[C@@H](C(=O)NCCN1CCOCC1)C(C)C |
| InChI | InChI=1S/C24H45N3O5/c1-4-5-6-7-8-9-10-11-20(18-21(28)29)23(30)26-22(19(2)3)24(31)25-12-13-27-14-16-32-17-15-27/h19-20,22H,4-18H2,1-3H3,(H,25,31)(H,26,30)(H,28,29)/t20-,22-/m1/s1 |
| InChIKey | AOSGJKRYMLLWAP-IFMALSPDSA-N |
| XLogP | 2.81 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|