C12H17N3O2 — CID 135684994
4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2-diol (PubChem CID 135684994) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135684994 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2-diol |
| SMILES | CN1CCN(/N=C/c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C12H17N3O2/c1-14-4-6-15(7-5-14)13-9-10-2-3-11(16)12(17)8-10/h2-3,8-9,16-17H,4-7H2,1H3/b13-9+ |
| InChIKey | LKHYSCOVCGKZAZ-UKTHLTGXSA-N |
| XLogP | 0.68 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|