C12H16N2O3 — CID 135716008
4-[(E)-piperidin-1-yliminomethyl]benzene-1,2,3-triol (PubChem CID 135716008) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-[(E)-piperidin-1-yliminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[(E)-piperidin-1-yliminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135716008 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-[(E)-piperidin-1-yliminomethyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(/C=N/N2CCCCC2)c(O)c1O |
| InChI | InChI=1S/C12H16N2O3/c15-10-5-4-9(11(16)12(10)17)8-13-14-6-2-1-3-7-14/h4-5,8,15-17H,1-3,6-7H2/b13-8+ |
| InChIKey | AVMNKOVFCTUHBA-MDWZMJQESA-N |
| XLogP | 1.62 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|