C19H22N2O2 — CID 136934972
4-[(E)-(4-benzylpiperidin-1-yl)iminomethyl]benzene-1,3-diol (PubChem CID 136934972) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[(E)-(4-benzylpiperidin-1-yl)iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-(4-benzylpiperidin-1-yl)iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136934972 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-[(E)-(4-benzylpiperidin-1-yl)iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/N2CCC(Cc3ccccc3)CC2)c(O)c1 |
| InChI | InChI=1S/C19H22N2O2/c22-18-7-6-17(19(23)13-18)14-20-21-10-8-16(9-11-21)12-15-4-2-1-3-5-15/h1-7,13-14,16,22-23H,8-12H2/b20-14+ |
| InChIKey | NJYGRMCCZLUWRP-XSFVSMFZSA-N |
| XLogP | 3.39 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|