C16H23N3O2 — CID 136934970
4-[(E)-(4-cyclopentylpiperazin-1-yl)iminomethyl]benzene-1,3-diol (PubChem CID 136934970) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[(E)-(4-cyclopentylpiperazin-1-yl)iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-(4-cyclopentylpiperazin-1-yl)iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136934970 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-[(E)-(4-cyclopentylpiperazin-1-yl)iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/N2CCN(C3CCCC3)CC2)c(O)c1 |
| InChI | InChI=1S/C16H23N3O2/c20-15-6-5-13(16(21)11-15)12-17-19-9-7-18(8-10-19)14-3-1-2-4-14/h5-6,11-12,14,20-21H,1-4,7-10H2/b17-12+ |
| InChIKey | KFDDUIMMXYGZBQ-SFQUDFHCSA-N |
| XLogP | 1.99 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|