C19H26N6O4 — CID 135685125
N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 135685125) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 135685125 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)C(C)n2nc(C)c([N+](=O)[O-])c2C)c(O)c1 |
| InChI | InChI=1S/C19H26N6O4/c1-6-23(7-2)16-9-8-15(17(26)10-16)11-20-21-19(27)14(5)24-13(4)18(25(28)29)12(3)22-24/h8-11,14,26H,6-7H2,1-5H3,(H,21,27)/b20-11+ |
| InChIKey | MHXVFOHOOZJNNH-RGVLZGJSSA-N |
| XLogP | 2.67 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|