C23H25N5O4 — CID 5059384
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[3-[(2-methylphenyl)methoxy]phenyl]methylideneamino]propanamide (PubChem CID 5059384) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[3-[(2-methylphenyl)methoxy]phenyl]methylideneamino]propanamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[3-[(2-methylphenyl)methoxy]phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 5059384 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[3-[(2-methylphenyl)methoxy]phenyl]methylideneamino]propanamide |
| SMILES | Cc1ccccc1COc1cccc(C=NNC(=O)C(C)n2nc(C)c([N+](=O)[O-])c2C)c1 |
| InChI | InChI=1S/C23H25N5O4/c1-15-8-5-6-10-20(15)14-32-21-11-7-9-19(12-21)13-24-25-23(29)18(4)27-17(3)22(28(30)31)16(2)26-27/h5-13,18H,14H2,1-4H3,(H,25,29) |
| InChIKey | ROMUMHMXULANOX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|