C21H26ClN3O3 — CID 136790469
(2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]propanamide (PubChem CID 136790469) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 136790469 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]propanamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)[C@@H](C)Oc2ccc(Cl)c(C)c2)c(O)c1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-5-25(6-2)17-8-7-16(20(26)12-17)13-23-24-21(27)15(4)28-18-9-10-19(22)14(3)11-18/h7-13,15,26H,5-6H2,1-4H3,(H,24,27)/b23-13-/t15-/m1/s1 |
| InChIKey | RXPUCFNTYQOBIQ-KSJDGYIASA-N |
| XLogP | 4.12 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|