C20H23ClN2O5 — CID 5431291
(2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide (PubChem CID 5431291) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 5431291 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1ccc(/C=N\NC(=O)[C@@H](C)Oc2ccc(Cl)c(C)c2)c(OC)c1OC |
| InChI | InChI=1S/C20H23ClN2O5/c1-12-10-15(7-8-16(12)21)28-13(2)20(24)23-22-11-14-6-9-17(25-3)19(27-5)18(14)26-4/h6-11,13H,1-5H3,(H,23,24)/b22-11-/t13-/m1/s1 |
| InChIKey | VFOGTUBNTPTVQI-MYSNOUKZSA-N |
| XLogP | 3.59 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|