C24H28N4O2 — CID 135688555
(5R)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 135688555) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (5R)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | (5R)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 135688555 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (5R)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | CCC(C)(C)[C@@H]1CCc2[nH]nc(C(=O)N/N=C/c3c(O)ccc4ccccc34)c2C1 |
| InChI | InChI=1S/C24H28N4O2/c1-4-24(2,3)16-10-11-20-18(13-16)22(27-26-20)23(30)28-25-14-19-17-8-6-5-7-15(17)9-12-21(19)29/h5-9,12,14,16,29H,4,10-11,13H2,1-3H3,(H,26,27)(H,28,30)/b25-14+/t16-/m1/s1 |
| InChIKey | MYHYEIJLPMYUCE-FRQJIFLKSA-N |
| XLogP | 4.57 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|