C21H27ClN4O — CID 3770779
N-[1-(4-chlorophenyl)ethylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 3770779) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)ethylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 3770779 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | CCC(C)(C)C1CCc2[nH]nc(C(=O)NN=C(C)c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C21H27ClN4O/c1-5-21(3,4)15-8-11-18-17(12-15)19(25-24-18)20(27)26-23-13(2)14-6-9-16(22)10-7-14/h6-7,9-10,15H,5,8,11-12H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | MYYAFYIFBUJZMJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|