C20H25BrN4O2 — CID 136906007
(5R)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 136906007) has the molecular formula C20H25BrN4O2 and a molecular weight of 433.35 g/mol. Its IUPAC name is (5R)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | (5R)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 136906007 |
| Molecular Formula | C20H25BrN4O2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (5R)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | CCC(C)(C)[C@@H]1CCc2[nH]nc(C(=O)N/N=C\c3cc(Br)ccc3O)c2C1 |
| InChI | InChI=1S/C20H25BrN4O2/c1-4-20(2,3)13-5-7-16-15(10-13)18(24-23-16)19(27)25-22-11-12-9-14(21)6-8-17(12)26/h6,8-9,11,13,26H,4-5,7,10H2,1-3H3,(H,23,24)(H,25,27)/b22-11-/t13-/m1/s1 |
| InChIKey | KJPZEPANAKZIFM-MYSNOUKZSA-N |
| XLogP | 4.18 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|