C22H30N4O3 — CID 3588845
N-[(3,4-dimethoxyphenyl)methylideneamino]-5-(2,2-dimethylpropyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 3588845) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methylideneamino]-5-(2,2-dimethylpropyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methylideneamino]-5-(2,2-dimethylpropyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 3588845 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methylideneamino]-5-(2,2-dimethylpropyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2n[nH]c3c2CC(CC(C)(C)C)CC3)cc1OC |
| InChI | InChI=1S/C22H30N4O3/c1-22(2,3)12-14-6-8-17-16(10-14)20(25-24-17)21(27)26-23-13-15-7-9-18(28-4)19(11-15)29-5/h7,9,11,13-14H,6,8,10,12H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | BEVAQYRYJLNDKW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|