C21H21N4O2S+ — CID 135690215
(4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-7,7-dimethyl-4-thiophen-2-yl-1,4,4a,6-tetrahydroquinazolin-3-ium-5-one (PubChem CID 135690215) has the molecular formula C21H21N4O2S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is (4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-7,7-dimethyl-4-thiophen-2-yl-1,4,4a,6-tetrahydroquinazolin-3-ium-5-one.
| Compound Name | (4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-7,7-dimethyl-4-thiophen-2-yl-1,4,4a,6-tetrahydroquinazolin-3-ium-5-one |
|---|---|
| PubChem CID | 135690215 |
| Molecular Formula | C21H21N4O2S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-7,7-dimethyl-4-thiophen-2-yl-1,4,4a,6-tetrahydroquinazolin-3-ium-5-one |
| SMILES | CC1(C)C=C2NC(Nc3nc4ccccc4o3)=[NH+][C@@H](c3cccs3)[C@@H]2C(=O)C1 |
| InChI | InChI=1S/C21H20N4O2S/c1-21(2)10-13-17(14(26)11-21)18(16-8-5-9-28-16)24-19(22-13)25-20-23-12-6-3-4-7-15(12)27-20/h3-10,17-18H,11H2,1-2H3,(H2,22,23,24,25)/p+1/t17-,18-/m0/s1 |
| InChIKey | POQQZZBMLXQQMG-ROUUACIJSA-O |
| XLogP | 2.58 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |