C21H17F2N4O2+ — CID 135690206
(4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-3-ium-5-one (PubChem CID 135690206) has the molecular formula C21H17F2N4O2+ and a molecular weight of 395.39 g/mol. Its IUPAC name is (4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-3-ium-5-one.
| Compound Name | (4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-3-ium-5-one |
|---|---|
| PubChem CID | 135690206 |
| Molecular Formula | C21H17F2N4O2+ |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (4R,4aS)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-3-ium-5-one |
| SMILES | O=C1CCC=C2NC(Nc3nc4ccccc4o3)=[NH+][C@@H](c3cc(F)cc(F)c3)[C@H]12 |
| InChI | InChI=1S/C21H16F2N4O2/c22-12-8-11(9-13(23)10-12)19-18-15(5-3-6-16(18)28)24-20(26-19)27-21-25-14-4-1-2-7-17(14)29-21/h1-2,4-5,7-10,18-19H,3,6H2,(H2,24,25,26,27)/p+1/t18-,19-/m0/s1 |
| InChIKey | UFBLSQIPOHQULA-OALUTQOASA-O |
| XLogP | 2.16 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |