C22H18F2N4O2 — CID 7660435
(4R,7R)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-7-methyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one (PubChem CID 7660435) has the molecular formula C22H18F2N4O2 and a molecular weight of 408.41 g/mol. Its IUPAC name is (4R,7R)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-7-methyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one.
| Compound Name | (4R,7R)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-7-methyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one |
|---|---|
| PubChem CID | 7660435 |
| Molecular Formula | C22H18F2N4O2 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (4R,7R)-2-(1,3-benzoxazol-2-ylamino)-4-(3,5-difluorophenyl)-7-methyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one |
| SMILES | C[C@H]1CC(=O)C2=C(C1)NC(Nc1nc3ccccc3o1)=N[C@@H]2c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H18F2N4O2/c1-11-6-16-19(17(29)7-11)20(12-8-13(23)10-14(24)9-12)27-21(25-16)28-22-26-15-4-2-3-5-18(15)30-22/h2-5,8-11,20H,6-7H2,1H3,(H2,25,26,27,28)/t11-,20-/m1/s1 |
| InChIKey | GOWUHNYZJLEMQE-BIBXISHDSA-N |
| XLogP | 4.47 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |