C26H25ClLiN5O3-2 — CID 156898676
lithium;2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-7-(oxomethyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one;N-ethylethanamine (PubChem CID 156898676) has the molecular formula C26H25ClLiN5O3-2 and a molecular weight of 497.91 g/mol. Its IUPAC name is lithium;2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-7-(oxomethyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one;N-ethylethanamine.
| Compound Name | lithium;2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-7-(oxomethyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one;N-ethylethanamine |
|---|---|
| PubChem CID | 156898676 |
| Molecular Formula | C26H25ClLiN5O3-2 |
| Molecular Weight | 497.91 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | lithium;2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-7-(oxomethyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one;N-ethylethanamine |
| SMILES | O=[C-]C1CC(=O)C2=C(C1)NC(Nc1nc3ccccc3o1)=NC2c1ccccc1Cl.[CH2-]CNC[CH2-].[Li+] |
| InChI | InChI=1S/C22H16ClN4O3.C4H9N.Li/c23-14-6-2-1-5-13(14)20-19-16(9-12(11-28)10-17(19)29)24-21(26-20)27-22-25-15-7-3-4-8-18(15)30-22;1-3-5-4-2;/h1-8,12,20H,9-10H2,(H2,24,25,26,27);5H,1-4H2;/q-1;-2;+1 |
| InChIKey | HXDRCCUNXAEHMV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.91 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|