C17H12N4O3 — CID 156587752
(5Z)-5-[[3-(1,3-benzoxazol-2-ylamino)phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 156587752) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is (5Z)-5-[[3-(1,3-benzoxazol-2-ylamino)phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-(1,3-benzoxazol-2-ylamino)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 156587752 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (5Z)-5-[[3-(1,3-benzoxazol-2-ylamino)phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cccc(Nc3nc4ccccc4o3)c2)N1 |
| InChI | InChI=1S/C17H12N4O3/c22-15-13(19-16(23)21-15)9-10-4-3-5-11(8-10)18-17-20-12-6-1-2-7-14(12)24-17/h1-9H,(H,18,20)(H2,19,21,22,23)/b13-9- |
| InChIKey | JCWIKZWFZVZRTM-LCYFTJDESA-N |
| XLogP | 2.75 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|