C30H25N5O4 — CID 135699184
2-N,4-N-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide (PubChem CID 135699184) has the molecular formula C30H25N5O4 and a molecular weight of 519.56 g/mol. Its IUPAC name is 2-N,4-N-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 135699184 |
| Molecular Formula | C30H25N5O4 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 2-N,4-N-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyl-1H-pyrrole-2,4-dicarboxamide |
| SMILES | Cc1[nH]c(C(=O)N/N=C/c2c(O)ccc3ccccc23)c(C)c1C(=O)N/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C30H25N5O4/c1-17-27(29(38)34-31-15-23-21-9-5-3-7-19(21)11-13-25(23)36)18(2)33-28(17)30(39)35-32-16-24-22-10-6-4-8-20(22)12-14-26(24)37/h3-16,33,36-37H,1-2H3,(H,34,38)(H,35,39)/b31-15+,32-16+ |
| InChIKey | AFYVKIGNWFTMCK-IHXWQEJPSA-N |
| XLogP | 4.88 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|