C13H11N5O3S2 — CID 135701402
N-[4-acetamido-2-(cyanomethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]thiophene-2-carboxamide (PubChem CID 135701402) has the molecular formula C13H11N5O3S2 and a molecular weight of 349.40 g/mol. Its IUPAC name is N-[4-acetamido-2-(cyanomethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[4-acetamido-2-(cyanomethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135701402 |
| Molecular Formula | C13H11N5O3S2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[4-acetamido-2-(cyanomethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1nc(SCC#N)[nH]c(=O)c1NC(=O)c1cccs1 |
| InChI | InChI=1S/C13H11N5O3S2/c1-7(19)15-10-9(16-11(20)8-3-2-5-22-8)12(21)18-13(17-10)23-6-4-14/h2-3,5H,6H2,1H3,(H,16,20)(H2,15,17,18,19,21) |
| InChIKey | CWDGTTKAWMHWAR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |