C15H14N4O3S2 — CID 135701377
N-[6-oxo-4-(propanoylamino)-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl]thiophene-2-carboxamide (PubChem CID 135701377) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[6-oxo-4-(propanoylamino)-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[6-oxo-4-(propanoylamino)-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135701377 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[6-oxo-4-(propanoylamino)-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl]thiophene-2-carboxamide |
| SMILES | C#CCSc1nc(NC(=O)CC)c(NC(=O)c2cccs2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H14N4O3S2/c1-3-7-24-15-18-12(16-10(20)4-2)11(14(22)19-15)17-13(21)9-6-5-8-23-9/h1,5-6,8H,4,7H2,2H3,(H,17,21)(H2,16,18,19,20,22) |
| InChIKey | MXCQLMGEXCFDCS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|