C17H12FN3S — CID 135702368
4-fluoro-3-(3H-imidazo[4,5-c]pyridin-2-yl)-7-methylnaphthalene-2-thiol (PubChem CID 135702368) has the molecular formula C17H12FN3S and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-fluoro-3-(3H-imidazo[4,5-c]pyridin-2-yl)-7-methylnaphthalene-2-thiol.
| Compound Name | 4-fluoro-3-(3H-imidazo[4,5-c]pyridin-2-yl)-7-methylnaphthalene-2-thiol |
|---|---|
| PubChem CID | 135702368 |
| Molecular Formula | C17H12FN3S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 4-fluoro-3-(3H-imidazo[4,5-c]pyridin-2-yl)-7-methylnaphthalene-2-thiol |
| SMILES | Cc1ccc2c(F)c(-c3nc4ccncc4[nH]3)c(S)cc2c1 |
| InChI | InChI=1S/C17H12FN3S/c1-9-2-3-11-10(6-9)7-14(22)15(16(11)18)17-20-12-4-5-19-8-13(12)21-17/h2-8,22H,1H3,(H,20,21) |
| InChIKey | ADPUJCLETAPICJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|