C14H7Br2ClF3NO — CID 135703144
2,4-dibromo-6-[[2-chloro-5-(trifluoromethyl)phenyl]iminomethyl]phenol (PubChem CID 135703144) has the molecular formula C14H7Br2ClF3NO and a molecular weight of 457.47 g/mol. Its IUPAC name is 2,4-dibromo-6-[[2-chloro-5-(trifluoromethyl)phenyl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[[2-chloro-5-(trifluoromethyl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135703144 |
| Molecular Formula | C14H7Br2ClF3NO |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 454.85 |
| IUPAC Name | 2,4-dibromo-6-[[2-chloro-5-(trifluoromethyl)phenyl]iminomethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H7Br2ClF3NO/c15-9-3-7(13(22)10(16)5-9)6-21-12-4-8(14(18,19)20)1-2-11(12)17/h1-6,22H/b21-6+ |
| InChIKey | ONFTXKAORJRTQM-AERZKKPOSA-N |
| XLogP | 6.34 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|