C19H19ClN4O2S — CID 135704446
N-(3-chloro-4-methoxyphenyl)-6-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine (PubChem CID 135704446) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-6-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-6-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 135704446 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-6-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine |
| SMILES | CCOc1ccc(-c2cc3n(n2)SC(Nc2ccc(OC)c(Cl)c2)N3)cc1 |
| InChI | InChI=1S/C19H19ClN4O2S/c1-3-26-14-7-4-12(5-8-14)16-11-18-22-19(27-24(18)23-16)21-13-6-9-17(25-2)15(20)10-13/h4-11,19,21-22H,3H2,1-2H3 |
| InChIKey | WYAPZXGUHDRYIY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|