C20H22N4O3S — CID 136913750
(2R)-6-(2,4-dimethoxyphenyl)-N-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine (PubChem CID 136913750) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is (2R)-6-(2,4-dimethoxyphenyl)-N-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine.
| Compound Name | (2R)-6-(2,4-dimethoxyphenyl)-N-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 136913750 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (2R)-6-(2,4-dimethoxyphenyl)-N-(4-ethoxyphenyl)-1,2-dihydropyrazolo[1,5-b][1,2,4]thiadiazol-2-amine |
| SMILES | CCOc1ccc(N[C@@H]2Nc3cc(-c4ccc(OC)cc4OC)nn3S2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-4-27-14-7-5-13(6-8-14)21-20-22-19-12-17(23-24(19)28-20)16-10-9-15(25-2)11-18(16)26-3/h5-12,20-22H,4H2,1-3H3/t20-/m1/s1 |
| InChIKey | XSPVELIAYHCWTB-HXUWFJFHSA-N |
| XLogP | 4.28 |
| TPSA | 69.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|