C24H18ClN5O3 — CID 135705574
2-(2-chloroindolo[2,3-b]quinoxalin-6-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135705574) has the molecular formula C24H18ClN5O3 and a molecular weight of 459.89 g/mol. Its IUPAC name is 2-(2-chloroindolo[2,3-b]quinoxalin-6-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-chloroindolo[2,3-b]quinoxalin-6-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135705574 |
| Molecular Formula | C24H18ClN5O3 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-(2-chloroindolo[2,3-b]quinoxalin-6-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2c3ccccc3c3nc4cc(Cl)ccc4nc32)ccc1O |
| InChI | InChI=1S/C24H18ClN5O3/c1-33-21-10-14(6-9-20(21)31)12-26-29-22(32)13-30-19-5-3-2-4-16(19)23-24(30)28-17-8-7-15(25)11-18(17)27-23/h2-12,31H,13H2,1H3,(H,29,32)/b26-12+ |
| InChIKey | BLYAIPLXVFIBPB-RPPGKUMJSA-N |
| XLogP | 4.26 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|