C23H26ClN3O4S — CID 135706478
N-[(4-butoxyphenyl)methyl]-2-[[5-(4-chlorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide (PubChem CID 135706478) has the molecular formula C23H26ClN3O4S and a molecular weight of 476.00 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-[[5-(4-chlorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-[[5-(4-chlorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 135706478 |
| Molecular Formula | C23H26ClN3O4S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-[[5-(4-chlorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)C/N=C2\NS(=O)(=O)C(c3ccc(Cl)cc3)=C2C)cc1 |
| InChI | InChI=1S/C23H26ClN3O4S/c1-3-4-13-31-20-11-5-17(6-12-20)14-25-21(28)15-26-23-16(2)22(32(29,30)27-23)18-7-9-19(24)10-8-18/h5-12H,3-4,13-15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | FMXFWAGFNZNEAT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|