C21H19N5O8S — CID 135707028
2,3-dimethoxy-6-[(Z)-[(E)-[5-[2-(4-nitroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid (PubChem CID 135707028) has the molecular formula C21H19N5O8S and a molecular weight of 501.48 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-[(E)-[5-[2-(4-nitroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2,3-dimethoxy-6-[(Z)-[(E)-[5-[2-(4-nitroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 135707028 |
| Molecular Formula | C21H19N5O8S |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-[(E)-[5-[2-(4-nitroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid |
| SMILES | COc1ccc(/C=N\N=C2/NC(=O)C(CC(=O)Nc3ccc([N+](=O)[O-])cc3)S2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C21H19N5O8S/c1-33-14-8-3-11(17(20(29)30)18(14)34-2)10-22-25-21-24-19(28)15(35-21)9-16(27)23-12-4-6-13(7-5-12)26(31)32/h3-8,10,15H,9H2,1-2H3,(H,23,27)(H,29,30)(H,24,25,28)/b22-10- |
| InChIKey | XTYAVDQJOAXQDL-YVNNLAQVSA-N |
| XLogP | 2.26 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|