C21H19ClN4O6S — CID 135770135
6-[(E)-[(Z)-[5-[2-(4-chloroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid (PubChem CID 135770135) has the molecular formula C21H19ClN4O6S and a molecular weight of 490.93 g/mol. Its IUPAC name is 6-[(E)-[(Z)-[5-[2-(4-chloroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(E)-[(Z)-[5-[2-(4-chloroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 135770135 |
| Molecular Formula | C21H19ClN4O6S |
| Molecular Weight | 490.93 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 6-[(E)-[(Z)-[5-[2-(4-chloroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(/C=N/N=C2/NC(=O)C(CC(=O)Nc3ccc(Cl)cc3)S2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C21H19ClN4O6S/c1-31-14-8-3-11(17(20(29)30)18(14)32-2)10-23-26-21-25-19(28)15(33-21)9-16(27)24-13-6-4-12(22)5-7-13/h3-8,10,15H,9H2,1-2H3,(H,24,27)(H,29,30)(H,25,26,28)/b23-10+ |
| InChIKey | QNILVJUGBLQBJK-AUEPDCJTSA-N |
| XLogP | 3.01 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.93 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|