C23H21N5O6S3 — CID 135707162
ethyl 4-[[2-[4-oxo-2-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 135707162) has the molecular formula C23H21N5O6S3 and a molecular weight of 559.65 g/mol. Its IUPAC name is ethyl 4-[[2-[4-oxo-2-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-oxo-2-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135707162 |
| Molecular Formula | C23H21N5O6S3 |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | ethyl 4-[[2-[4-oxo-2-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC2S/C(=N\c3ccc(S(=O)(=O)Nc4nccs4)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C23H21N5O6S3/c1-2-34-21(31)14-3-5-15(6-4-14)25-19(29)13-18-20(30)27-23(36-18)26-16-7-9-17(10-8-16)37(32,33)28-22-24-11-12-35-22/h3-12,18H,2,13H2,1H3,(H,24,28)(H,25,29)(H,26,27,30) |
| InChIKey | FITRNRNHGCMYAD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|