C16H11ClN3O3- — CID 135708292
2-[(5-chloro-2-hydroxy-7-methyl-1H-indol-3-yl)diazenyl]benzoate (PubChem CID 135708292) has the molecular formula C16H11ClN3O3- and a molecular weight of 328.74 g/mol. Its IUPAC name is 2-[(5-chloro-2-hydroxy-7-methyl-1H-indol-3-yl)diazenyl]benzoate.
| Compound Name | 2-[(5-chloro-2-hydroxy-7-methyl-1H-indol-3-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135708292 |
| Molecular Formula | C16H11ClN3O3- |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[(5-chloro-2-hydroxy-7-methyl-1H-indol-3-yl)diazenyl]benzoate |
| SMILES | Cc1cc(Cl)cc2c(/N=N/c3ccccc3C(=O)[O-])c(O)[nH]c12 |
| InChI | InChI=1S/C16H12ClN3O3/c1-8-6-9(17)7-11-13(8)18-15(21)14(11)20-19-12-5-3-2-4-10(12)16(22)23/h2-7,18,21H,1H3,(H,22,23)/p-1/b20-19+ |
| InChIKey | FLWAVNJZQRGLOG-FMQUCBEESA-M |
| XLogP | 3.61 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|