C22H21FN6O4 — CID 135709978
N-(4-fluorophenyl)-2-(3-hydroxypropyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135709978) has the molecular formula C22H21FN6O4 and a molecular weight of 452.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(3-hydroxypropyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-(3-hydroxypropyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135709978 |
| Molecular Formula | C22H21FN6O4 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-(4-fluorophenyl)-2-(3-hydroxypropyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(F)cc2)C(c2ccccc2[N+](=O)[O-])n2nc(CCCO)nc2N1 |
| InChI | InChI=1S/C22H21FN6O4/c1-13-19(21(31)25-15-10-8-14(23)9-11-15)20(16-5-2-3-6-17(16)29(32)33)28-22(24-13)26-18(27-28)7-4-12-30/h2-3,5-6,8-11,20,30H,4,7,12H2,1H3,(H,25,31)(H,24,26,27) |
| InChIKey | FQYQGSMJSLWBNE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|