C29H29N7O3 — CID 135579685
2-[4-(diethylamino)phenyl]-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135579685) has the molecular formula C29H29N7O3 and a molecular weight of 523.60 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[4-(diethylamino)phenyl]-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135579685 |
| Molecular Formula | C29H29N7O3 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)c1ccc(-c2nc3n(n2)C(c2ccccc2[N+](=O)[O-])C(C(=O)Nc2ccccc2)=C(C)N3)cc1 |
| InChI | InChI=1S/C29H29N7O3/c1-4-34(5-2)22-17-15-20(16-18-22)27-32-29-30-19(3)25(28(37)31-21-11-7-6-8-12-21)26(35(29)33-27)23-13-9-10-14-24(23)36(38)39/h6-18,26H,4-5H2,1-3H3,(H,31,37)(H,30,32,33) |
| InChIKey | RVBPIHMBVLPJNN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|