C25H18Cl2N6O3 — CID 135704171
2-(2,4-dichlorophenyl)-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135704171) has the molecular formula C25H18Cl2N6O3 and a molecular weight of 521.36 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135704171 |
| Molecular Formula | C25H18Cl2N6O3 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methyl-7-(2-nitrophenyl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccccc2[N+](=O)[O-])n2nc(-c3ccc(Cl)cc3Cl)nc2N1 |
| InChI | InChI=1S/C25H18Cl2N6O3/c1-14-21(24(34)29-16-7-3-2-4-8-16)22(18-9-5-6-10-20(18)33(35)36)32-25(28-14)30-23(31-32)17-12-11-15(26)13-19(17)27/h2-13,22H,1H3,(H,29,34)(H,28,30,31) |
| InChIKey | JVODWAVOQBTGBL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|