C26H20Cl2N6O4 — CID 135575518
2-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135575518) has the molecular formula C26H20Cl2N6O4 and a molecular weight of 551.39 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135575518 |
| Molecular Formula | C26H20Cl2N6O4 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-7-(2-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3ccc(Cl)cc3Cl)nn2C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H20Cl2N6O4/c1-14-22(25(35)30-19-8-4-6-10-21(19)38-2)23(17-7-3-5-9-20(17)34(36)37)33-26(29-14)31-24(32-33)16-12-11-15(27)13-18(16)28/h3-13,23H,1-2H3,(H,30,35)(H,29,31,32) |
| InChIKey | XOZGQHNANHANKK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|