C26H21Cl2N5O3 — CID 135776287
7-(2,4-dichlorophenyl)-2-(4-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135776287) has the molecular formula C26H21Cl2N5O3 and a molecular weight of 522.39 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-2-(4-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,4-dichlorophenyl)-2-(4-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135776287 |
| Molecular Formula | C26H21Cl2N5O3 |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-2-(4-hydroxyphenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3ccc(O)cc3)nn2C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H21Cl2N5O3/c1-14-22(25(35)30-20-5-3-4-6-21(20)36-2)23(18-12-9-16(27)13-19(18)28)33-26(29-14)31-24(32-33)15-7-10-17(34)11-8-15/h3-13,23,34H,1-2H3,(H,30,35)(H,29,31,32) |
| InChIKey | JHCWGAJBDCAERD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |