C26H21Cl2N5O2 — CID 135847509
2,7-bis(2-chlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135847509) has the molecular formula C26H21Cl2N5O2 and a molecular weight of 506.39 g/mol. Its IUPAC name is 2,7-bis(2-chlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2,7-bis(2-chlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135847509 |
| Molecular Formula | C26H21Cl2N5O2 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 2,7-bis(2-chlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3ccccc3Cl)nn2C1c1ccccc1Cl |
| InChI | InChI=1S/C26H21Cl2N5O2/c1-15-22(25(34)30-20-13-7-8-14-21(20)35-2)23(16-9-3-5-11-18(16)27)33-26(29-15)31-24(32-33)17-10-4-6-12-19(17)28/h3-14,23H,1-2H3,(H,30,34)(H,29,31,32) |
| InChIKey | VPNIVYDAZHQHHN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |