C26H20Cl3N5O2 — CID 135768864
2-(4-chlorophenyl)-7-(2,3-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135768864) has the molecular formula C26H20Cl3N5O2 and a molecular weight of 540.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-(2,3-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-7-(2,3-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135768864 |
| Molecular Formula | C26H20Cl3N5O2 |
| Molecular Weight | 540.84 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 2-(4-chlorophenyl)-7-(2,3-dichlorophenyl)-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)Nc2nc(-c3ccc(Cl)cc3)nn2C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C26H20Cl3N5O2/c1-14-21(25(35)31-19-8-3-4-9-20(19)36-2)23(17-6-5-7-18(28)22(17)29)34-26(30-14)32-24(33-34)15-10-12-16(27)13-11-15/h3-13,23H,1-2H3,(H,31,35)(H,30,32,33) |
| InChIKey | LZQBPPUZVPZFMH-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.84 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |