C24H17Cl2FN6O — CID 135584353
7-(2,3-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135584353) has the molecular formula C24H17Cl2FN6O and a molecular weight of 495.35 g/mol. Its IUPAC name is 7-(2,3-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,3-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135584353 |
| Molecular Formula | C24H17Cl2FN6O |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 7-(2,3-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-pyridin-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccn2)C(c2cccc(Cl)c2Cl)n2nc(-c3ccc(F)cc3)nc2N1 |
| InChI | InChI=1S/C24H17Cl2FN6O/c1-13-19(23(34)30-18-7-2-3-12-28-18)21(16-5-4-6-17(25)20(16)26)33-24(29-13)31-22(32-33)14-8-10-15(27)11-9-14/h2-12,21H,1H3,(H,28,30,34)(H,29,31,32) |
| InChIKey | UCZSLJPMQAEYBO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |